ChemNet > CAS > 62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide
62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide
| Nama produk |
3-chlorobenzo[b]thiophene-2-carbohydrazide |
| Sinonim |
3-chloro-1-benzothiophene-2-carbohydrazide; 3-Chlorobenzothiophene-2-carboxylic acid hydrazide |
| MF |
C9H7ClN2OS |
| Berat Molekul |
226.6827 |
| InChI |
InChI=1/C9H7ClN2OS/c10-7-5-3-1-2-4-6(5)14-8(7)9(13)12-11/h1-4H,11H2,(H,12,13) |
| CAS NO |
62524-21-4 |
| Struktur Molekul |
![62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide](https://images-a.chemnet.com/suppliers/chembase/132/13230.gif)
|
| Kepadatan |
1.486g/cm3 |
| Titik lebur |
181℃ |
| Indeks bias |
1.714 |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
